C22H27N3O8S — CID 42924057
N-[2-[2-[2-(4-ethoxyphenoxy)propanoyl]hydrazinyl]-2-oxoethyl]-N-methyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 42924057) has the molecular formula C22H27N3O8S and a molecular weight of 493.54 g/mol. Its IUPAC name is N-[2-[2-[2-(4-ethoxyphenoxy)propanoyl]hydrazinyl]-2-oxoethyl]-N-methyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-[2-[2-[2-(4-ethoxyphenoxy)propanoyl]hydrazinyl]-2-oxoethyl]-N-methyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 42924057 |
| Molecular Formula | C22H27N3O8S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | N-[2-[2-[2-(4-ethoxyphenoxy)propanoyl]hydrazinyl]-2-oxoethyl]-N-methyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | CCOc1ccc(OC(C)C(=O)NNC(=O)CN(C)S(=O)(=O)c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C22H27N3O8S/c1-4-30-16-5-7-17(8-6-16)33-15(2)22(27)24-23-21(26)14-25(3)34(28,29)18-9-10-19-20(13-18)32-12-11-31-19/h5-10,13,15H,4,11-12,14H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | CUXKPCRIYTWLLT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|