About 3-[(2E)-2-ethoxyiminopropyl]-N-methyl-1,2,4-thiadiazol-5-amine
3-[(2E)-2-ethoxyiminopropyl]-N-methyl-1,2,4-thiadiazol-5-amine (PubChem CID 42924877) has the molecular formula C8H14N4OS
and a molecular weight of 214.29 g/mol. Its IUPAC name is 3-[(2E)-2-ethoxyiminopropyl]-N-methyl-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | 3-[(2E)-2-ethoxyiminopropyl]-N-methyl-1,2,4-thiadiazol-5-amine |
| PubChem CID | 42924877 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 3-[(2E)-2-ethoxyiminopropyl]-N-methyl-1,2,4-thiadiazol-5-amine |
| SMILES | CCO/N=C(\C)Cc1nsc(NC)n1 |
| InChI | InChI=1S/C8H14N4OS/c1-4-13-11-6(2)5-7-10-8(9-3)14-12-7/h4-5H2,1-3H3,(H,9,10,12)/b11-6+ |
| InChIKey | ZXUDVLYGNLZPGF-IZZDOVSWSA-N |
| XLogP | 1.53 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2E)-2-ethoxyiminopropyl]-N-methyl-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2E)-2-ethoxyiminopropyl]-N-methyl-1,2,4-thiadiazol-5-amine?
The IUPAC name of 3-[(2E)-2-ethoxyiminopropyl]-N-methyl-1,2,4-thiadiazol-5-amine (CID 42924877) is 3-[(2E)-2-ethoxyiminopropyl]-N-methyl-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for 3-[(2E)-2-ethoxyiminopropyl]-N-methyl-1,2,4-thiadiazol-5-amine?
The canonical SMILES for 3-[(2E)-2-ethoxyiminopropyl]-N-methyl-1,2,4-thiadiazol-5-amine is CCO/N=C(\C)Cc1nsc(NC)n1.
What is the InChIKey of 3-[(2E)-2-ethoxyiminopropyl]-N-methyl-1,2,4-thiadiazol-5-amine?
The InChIKey is ZXUDVLYGNLZPGF-IZZDOVSWSA-N. The full InChI is InChI=1S/C8H14N4OS/c1-4-13-11-6(2)5-7-10-8(9-3)14-12-7/h4-5H2,1-3H3,(H,9,10,12)/b11-6+.
What are the key properties of 3-[(2E)-2-ethoxyiminopropyl]-N-methyl-1,2,4-thiadiazol-5-amine?
3-[(2E)-2-ethoxyiminopropyl]-N-methyl-1,2,4-thiadiazol-5-amine has a molecular weight of 214.29 g/mol, XLogP of 1.53, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2E)-2-ethoxyiminopropyl]-N-methyl-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 42924877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).