About (E)-N-methoxy-1-(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methanimine
(E)-N-methoxy-1-(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methanimine (PubChem CID 42924897) has the molecular formula C8H9N3O2S
and a molecular weight of 211.25 g/mol. Its IUPAC name is (E)-N-methoxy-1-(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methanimine.
Molecular Properties
| Compound Name | (E)-N-methoxy-1-(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methanimine |
| PubChem CID | 42924897 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | (E)-N-methoxy-1-(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methanimine |
| SMILES | CO/N=C/c1c(OC)nc2sccn12 |
| InChI | InChI=1S/C8H9N3O2S/c1-12-7-6(5-9-13-2)11-3-4-14-8(11)10-7/h3-5H,1-2H3/b9-5+ |
| InChIKey | WQXYMHDSKATTSB-WEVVVXLNSA-N |
| XLogP | 1.38 |
| TPSA | 48.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-methoxy-1-(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-methoxy-1-(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methanimine?
The IUPAC name of (E)-N-methoxy-1-(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methanimine (CID 42924897) is (E)-N-methoxy-1-(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methanimine.
What is the SMILES notation for (E)-N-methoxy-1-(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methanimine?
The canonical SMILES for (E)-N-methoxy-1-(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methanimine is CO/N=C/c1c(OC)nc2sccn12.
What is the InChIKey of (E)-N-methoxy-1-(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methanimine?
The InChIKey is WQXYMHDSKATTSB-WEVVVXLNSA-N. The full InChI is InChI=1S/C8H9N3O2S/c1-12-7-6(5-9-13-2)11-3-4-14-8(11)10-7/h3-5H,1-2H3/b9-5+.
What are the key properties of (E)-N-methoxy-1-(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methanimine?
(E)-N-methoxy-1-(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methanimine has a molecular weight of 211.25 g/mol, XLogP of 1.38, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-methoxy-1-(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methanimine is sourced from PubChem (CID 42924897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).