C21H24ClN3O4S — CID 42924913
1-[2-chloro-5-(dimethylsulfamoyl)benzoyl]-N-phenylpiperidine-3-carboxamide (PubChem CID 42924913) has the molecular formula C21H24ClN3O4S and a molecular weight of 449.96 g/mol. Its IUPAC name is 1-[2-chloro-5-(dimethylsulfamoyl)benzoyl]-N-phenylpiperidine-3-carboxamide.
| Compound Name | 1-[2-chloro-5-(dimethylsulfamoyl)benzoyl]-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42924913 |
| Molecular Formula | C21H24ClN3O4S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 1-[2-chloro-5-(dimethylsulfamoyl)benzoyl]-N-phenylpiperidine-3-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(C(=O)N2CCCC(C(=O)Nc3ccccc3)C2)c1 |
| InChI | InChI=1S/C21H24ClN3O4S/c1-24(2)30(28,29)17-10-11-19(22)18(13-17)21(27)25-12-6-7-15(14-25)20(26)23-16-8-4-3-5-9-16/h3-5,8-11,13,15H,6-7,12,14H2,1-2H3,(H,23,26) |
| InChIKey | OXRIVWWXLCGIAI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |