About N-phenyl-1-[2-(1,2,4-triazol-1-yl)acetyl]piperidine-3-carboxamide
N-phenyl-1-[2-(1,2,4-triazol-1-yl)acetyl]piperidine-3-carboxamide (PubChem CID 42925469) has the molecular formula C16H19N5O2
and a molecular weight of 313.36 g/mol. Its IUPAC name is N-phenyl-1-[2-(1,2,4-triazol-1-yl)acetyl]piperidine-3-carboxamide.
Molecular Properties
| Compound Name | N-phenyl-1-[2-(1,2,4-triazol-1-yl)acetyl]piperidine-3-carboxamide |
| PubChem CID | 42925469 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N-phenyl-1-[2-(1,2,4-triazol-1-yl)acetyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCCN(C(=O)Cn2cncn2)C1 |
| InChI | InChI=1S/C16H19N5O2/c22-15(10-21-12-17-11-18-21)20-8-4-5-13(9-20)16(23)19-14-6-2-1-3-7-14/h1-3,6-7,11-13H,4-5,8-10H2,(H,19,23) |
| InChIKey | WNQLWISAABRCBU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-phenyl-1-[2-(1,2,4-triazol-1-yl)acetyl]piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-1-[2-(1,2,4-triazol-1-yl)acetyl]piperidine-3-carboxamide?
The IUPAC name of N-phenyl-1-[2-(1,2,4-triazol-1-yl)acetyl]piperidine-3-carboxamide (CID 42925469) is N-phenyl-1-[2-(1,2,4-triazol-1-yl)acetyl]piperidine-3-carboxamide.
What is the SMILES notation for N-phenyl-1-[2-(1,2,4-triazol-1-yl)acetyl]piperidine-3-carboxamide?
The canonical SMILES for N-phenyl-1-[2-(1,2,4-triazol-1-yl)acetyl]piperidine-3-carboxamide is O=C(Nc1ccccc1)C1CCCN(C(=O)Cn2cncn2)C1.
What is the InChIKey of N-phenyl-1-[2-(1,2,4-triazol-1-yl)acetyl]piperidine-3-carboxamide?
The InChIKey is WNQLWISAABRCBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N5O2/c22-15(10-21-12-17-11-18-21)20-8-4-5-13(9-20)16(23)19-14-6-2-1-3-7-14/h1-3,6-7,11-13H,4-5,8-10H2,(H,19,23).
What are the key properties of N-phenyl-1-[2-(1,2,4-triazol-1-yl)acetyl]piperidine-3-carboxamide?
N-phenyl-1-[2-(1,2,4-triazol-1-yl)acetyl]piperidine-3-carboxamide has a molecular weight of 313.36 g/mol, XLogP of 1.16, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-1-[2-(1,2,4-triazol-1-yl)acetyl]piperidine-3-carboxamide is sourced from PubChem (CID 42925469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).