C21H20N4O3 — CID 42926429
1-(8-nitroisoquinolin-5-yl)-N-phenylpiperidine-3-carboxamide (PubChem CID 42926429) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 1-(8-nitroisoquinolin-5-yl)-N-phenylpiperidine-3-carboxamide.
| Compound Name | 1-(8-nitroisoquinolin-5-yl)-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42926429 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 1-(8-nitroisoquinolin-5-yl)-N-phenylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCCN(c2ccc([N+](=O)[O-])c3cnccc23)C1 |
| InChI | InChI=1S/C21H20N4O3/c26-21(23-16-6-2-1-3-7-16)15-5-4-12-24(14-15)19-8-9-20(25(27)28)18-13-22-11-10-17(18)19/h1-3,6-11,13,15H,4-5,12,14H2,(H,23,26) |
| InChIKey | VRUXCQUGZMPYGX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|