C13H23N3O2 — CID 42927300
3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-N-carbamoylpropanamide (PubChem CID 42927300) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-N-carbamoylpropanamide.
| Compound Name | 3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-N-carbamoylpropanamide |
|---|---|
| PubChem CID | 42927300 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-N-carbamoylpropanamide |
| SMILES | NC(=O)NC(=O)CCN1CCCC2CCCCC21 |
| InChI | InChI=1S/C13H23N3O2/c14-13(18)15-12(17)7-9-16-8-3-5-10-4-1-2-6-11(10)16/h10-11H,1-9H2,(H3,14,15,17,18) |
| InChIKey | RKDIWOYOFSVKQZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |