About (7-acetamido-2-oxochromen-4-yl)methyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate
(7-acetamido-2-oxochromen-4-yl)methyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate (PubChem CID 42928948) has the molecular formula C20H21N3O5
and a molecular weight of 383.40 g/mol. Its IUPAC name is (7-acetamido-2-oxochromen-4-yl)methyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate.
Molecular Properties
| Compound Name | (7-acetamido-2-oxochromen-4-yl)methyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate |
| PubChem CID | 42928948 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | (7-acetamido-2-oxochromen-4-yl)methyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate |
| SMILES | CC(=O)Nc1ccc2c(COC(=O)Cc3c(C)nn(C)c3C)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H21N3O5/c1-11-17(12(2)23(4)22-11)9-19(25)27-10-14-7-20(26)28-18-8-15(21-13(3)24)5-6-16(14)18/h5-8H,9-10H2,1-4H3,(H,21,24) |
| InChIKey | QZBISDVYXRFJFK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze (7-acetamido-2-oxochromen-4-yl)methyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-acetamido-2-oxochromen-4-yl)methyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate?
The IUPAC name of (7-acetamido-2-oxochromen-4-yl)methyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate (CID 42928948) is (7-acetamido-2-oxochromen-4-yl)methyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate.
What is the SMILES notation for (7-acetamido-2-oxochromen-4-yl)methyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate?
The canonical SMILES for (7-acetamido-2-oxochromen-4-yl)methyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate is CC(=O)Nc1ccc2c(COC(=O)Cc3c(C)nn(C)c3C)cc(=O)oc2c1.
What is the InChIKey of (7-acetamido-2-oxochromen-4-yl)methyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate?
The InChIKey is QZBISDVYXRFJFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O5/c1-11-17(12(2)23(4)22-11)9-19(25)27-10-14-7-20(26)28-18-8-15(21-13(3)24)5-6-16(14)18/h5-8H,9-10H2,1-4H3,(H,21,24).
What are the key properties of (7-acetamido-2-oxochromen-4-yl)methyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate?
(7-acetamido-2-oxochromen-4-yl)methyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate has a molecular weight of 383.40 g/mol, XLogP of 2.39, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (7-acetamido-2-oxochromen-4-yl)methyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate is sourced from PubChem (CID 42928948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).