C19H25NO2 — CID 42929411
(E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-(2,3-dimethylcyclohexyl)prop-2-enamide (PubChem CID 42929411) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-(2,3-dimethylcyclohexyl)prop-2-enamide.
| Compound Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-(2,3-dimethylcyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 42929411 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-(2,3-dimethylcyclohexyl)prop-2-enamide |
| SMILES | CC1CCCC(NC(=O)/C=C/c2ccc3c(c2)CCO3)C1C |
| InChI | InChI=1S/C19H25NO2/c1-13-4-3-5-17(14(13)2)20-19(21)9-7-15-6-8-18-16(12-15)10-11-22-18/h6-9,12-14,17H,3-5,10-11H2,1-2H3,(H,20,21)/b9-7+ |
| InChIKey | SPYHDNNZFCMOCO-VQHVLOKHSA-N |
| XLogP | 3.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|