About 2-N-(thiophen-2-ylmethyl)thiophene-2,5-disulfonamide
2-N-(thiophen-2-ylmethyl)thiophene-2,5-disulfonamide (PubChem CID 4293) has the molecular formula C9H10N2O4S4
and a molecular weight of 338.46 g/mol. Its IUPAC name is 2-N-(thiophen-2-ylmethyl)thiophene-2,5-disulfonamide.
Molecular Properties
| Compound Name | 2-N-(thiophen-2-ylmethyl)thiophene-2,5-disulfonamide |
| PubChem CID | 4293 |
| Molecular Formula | C9H10N2O4S4 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 337.95 |
| IUPAC Name | 2-N-(thiophen-2-ylmethyl)thiophene-2,5-disulfonamide |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)NCc2cccs2)s1 |
| InChI | InChI=1S/C9H10N2O4S4/c10-18(12,13)8-3-4-9(17-8)19(14,15)11-6-7-2-1-5-16-7/h1-5,11H,6H2,(H2,10,12,13) |
| InChIKey | STOTVDLYLKWVJB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-N-(thiophen-2-ylmethyl)thiophene-2,5-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(thiophen-2-ylmethyl)thiophene-2,5-disulfonamide?
The IUPAC name of 2-N-(thiophen-2-ylmethyl)thiophene-2,5-disulfonamide (CID 4293) is 2-N-(thiophen-2-ylmethyl)thiophene-2,5-disulfonamide.
What is the SMILES notation for 2-N-(thiophen-2-ylmethyl)thiophene-2,5-disulfonamide?
The canonical SMILES for 2-N-(thiophen-2-ylmethyl)thiophene-2,5-disulfonamide is NS(=O)(=O)c1ccc(S(=O)(=O)NCc2cccs2)s1.
What is the InChIKey of 2-N-(thiophen-2-ylmethyl)thiophene-2,5-disulfonamide?
The InChIKey is STOTVDLYLKWVJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O4S4/c10-18(12,13)8-3-4-9(17-8)19(14,15)11-6-7-2-1-5-16-7/h1-5,11H,6H2,(H2,10,12,13).
What are the key properties of 2-N-(thiophen-2-ylmethyl)thiophene-2,5-disulfonamide?
2-N-(thiophen-2-ylmethyl)thiophene-2,5-disulfonamide has a molecular weight of 338.46 g/mol, XLogP of 0.94, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(thiophen-2-ylmethyl)thiophene-2,5-disulfonamide is sourced from PubChem (CID 4293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).