C19H16ClFN4O — CID 42930849
N-(4-chloro-2-fluorophenyl)-1-quinazolin-4-ylpyrrolidine-2-carboxamide (PubChem CID 42930849) has the molecular formula C19H16ClFN4O and a molecular weight of 370.82 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-1-quinazolin-4-ylpyrrolidine-2-carboxamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-1-quinazolin-4-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 42930849 |
| Molecular Formula | C19H16ClFN4O |
| Molecular Weight | 370.82 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-1-quinazolin-4-ylpyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1F)C1CCCN1c1ncnc2ccccc12 |
| InChI | InChI=1S/C19H16ClFN4O/c20-12-7-8-16(14(21)10-12)24-19(26)17-6-3-9-25(17)18-13-4-1-2-5-15(13)22-11-23-18/h1-2,4-5,7-8,10-11,17H,3,6,9H2,(H,24,26) |
| InChIKey | ATGQBIBWWFWRLL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.82 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |