C23H28N2O7S — CID 42931170
1-[4-[4-(4-methoxyphenoxy)butanoylamino]phenyl]sulfonylpiperidine-3-carboxylic acid (PubChem CID 42931170) has the molecular formula C23H28N2O7S and a molecular weight of 476.55 g/mol. Its IUPAC name is 1-[4-[4-(4-methoxyphenoxy)butanoylamino]phenyl]sulfonylpiperidine-3-carboxylic acid.
| Compound Name | 1-[4-[4-(4-methoxyphenoxy)butanoylamino]phenyl]sulfonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 42931170 |
| Molecular Formula | C23H28N2O7S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 1-[4-[4-(4-methoxyphenoxy)butanoylamino]phenyl]sulfonylpiperidine-3-carboxylic acid |
| SMILES | COc1ccc(OCCCC(=O)Nc2ccc(S(=O)(=O)N3CCCC(C(=O)O)C3)cc2)cc1 |
| InChI | InChI=1S/C23H28N2O7S/c1-31-19-8-10-20(11-9-19)32-15-3-5-22(26)24-18-6-12-21(13-7-18)33(29,30)25-14-2-4-17(16-25)23(27)28/h6-13,17H,2-5,14-16H2,1H3,(H,24,26)(H,27,28) |
| InChIKey | GOERLFKGJZPODE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|