C20H16FN3O4 — CID 42932351
(2-amino-2-oxo-1-phenylethyl) 1-(2-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxylate (PubChem CID 42932351) has the molecular formula C20H16FN3O4 and a molecular weight of 381.36 g/mol. Its IUPAC name is (2-amino-2-oxo-1-phenylethyl) 1-(2-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxylate.
| Compound Name | (2-amino-2-oxo-1-phenylethyl) 1-(2-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 42932351 |
| Molecular Formula | C20H16FN3O4 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | (2-amino-2-oxo-1-phenylethyl) 1-(2-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxylate |
| SMILES | Cc1cc(=O)c(C(=O)OC(C(N)=O)c2ccccc2)nn1-c1ccccc1F |
| InChI | InChI=1S/C20H16FN3O4/c1-12-11-16(25)17(23-24(12)15-10-6-5-9-14(15)21)20(27)28-18(19(22)26)13-7-3-2-4-8-13/h2-11,18H,1H3,(H2,22,26) |
| InChIKey | FQFMIPFVBLIOTF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |