About N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide;hydrochloride
N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 42933701) has the molecular formula C8H14ClF3N2O
and a molecular weight of 246.66 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide;hydrochloride |
| PubChem CID | 42933701 |
| Molecular Formula | C8H14ClF3N2O |
| Molecular Weight | 246.66 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCC(F)(F)F)C1CCNCC1 |
| InChI | InChI=1S/C8H13F3N2O.ClH/c9-8(10,11)5-13-7(14)6-1-3-12-4-2-6;/h6,12H,1-5H2,(H,13,14);1H |
| InChIKey | DGLVNKMHXSIKLU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.66 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide;hydrochloride?
The IUPAC name of N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide;hydrochloride (CID 42933701) is N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide;hydrochloride.
What is the SMILES notation for N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide;hydrochloride?
The canonical SMILES for N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide;hydrochloride is Cl.O=C(NCC(F)(F)F)C1CCNCC1.
What is the InChIKey of N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide;hydrochloride?
The InChIKey is DGLVNKMHXSIKLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3N2O.ClH/c9-8(10,11)5-13-7(14)6-1-3-12-4-2-6;/h6,12H,1-5H2,(H,13,14);1H.
What are the key properties of N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide;hydrochloride?
N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide;hydrochloride has a molecular weight of 246.66 g/mol, XLogP of 1.09, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide;hydrochloride is sourced from PubChem (CID 42933701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).