About 3-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]azepan-2-one
3-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]azepan-2-one (PubChem CID 42934918) has the molecular formula C15H24N4OS
and a molecular weight of 308.45 g/mol. Its IUPAC name is 3-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]azepan-2-one.
Molecular Properties
| Compound Name | 3-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]azepan-2-one |
| PubChem CID | 42934918 |
| Molecular Formula | C15H24N4OS |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 3-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]azepan-2-one |
| SMILES | Cc1nc(CN2CCN(C3CCCCNC3=O)CC2)cs1 |
| InChI | InChI=1S/C15H24N4OS/c1-12-17-13(11-21-12)10-18-6-8-19(9-7-18)14-4-2-3-5-16-15(14)20/h11,14H,2-10H2,1H3,(H,16,20) |
| InChIKey | CTAVXBABNNUDEM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]azepan-2-one?
The IUPAC name of 3-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]azepan-2-one (CID 42934918) is 3-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]azepan-2-one.
What is the SMILES notation for 3-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]azepan-2-one?
The canonical SMILES for 3-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]azepan-2-one is Cc1nc(CN2CCN(C3CCCCNC3=O)CC2)cs1.
What is the InChIKey of 3-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]azepan-2-one?
The InChIKey is CTAVXBABNNUDEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4OS/c1-12-17-13(11-21-12)10-18-6-8-19(9-7-18)14-4-2-3-5-16-15(14)20/h11,14H,2-10H2,1H3,(H,16,20).
What are the key properties of 3-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]azepan-2-one?
3-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]azepan-2-one has a molecular weight of 308.45 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]azepan-2-one is sourced from PubChem (CID 42934918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).