About tert-butyl N-[(E)-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methylideneamino]carbamate
tert-butyl N-[(E)-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methylideneamino]carbamate (PubChem CID 42934987) has the molecular formula C12H18N4O4
and a molecular weight of 282.30 g/mol. Its IUPAC name is tert-butyl N-[(E)-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methylideneamino]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(E)-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methylideneamino]carbamate |
| PubChem CID | 42934987 |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | tert-butyl N-[(E)-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methylideneamino]carbamate |
| SMILES | Cn1cc(/C=N/NC(=O)OC(C)(C)C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C12H18N4O4/c1-12(2,3)20-10(18)14-13-6-8-7-15(4)11(19)16(5)9(8)17/h6-7H,1-5H3,(H,14,18)/b13-6+ |
| InChIKey | DLDFHDISLDHXDO-AWNIVKPZSA-N |
| XLogP | -0.06 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(E)-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methylideneamino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(E)-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methylideneamino]carbamate?
The IUPAC name of tert-butyl N-[(E)-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methylideneamino]carbamate (CID 42934987) is tert-butyl N-[(E)-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methylideneamino]carbamate.
What is the SMILES notation for tert-butyl N-[(E)-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methylideneamino]carbamate?
The canonical SMILES for tert-butyl N-[(E)-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methylideneamino]carbamate is Cn1cc(/C=N/NC(=O)OC(C)(C)C)c(=O)n(C)c1=O.
What is the InChIKey of tert-butyl N-[(E)-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methylideneamino]carbamate?
The InChIKey is DLDFHDISLDHXDO-AWNIVKPZSA-N. The full InChI is InChI=1S/C12H18N4O4/c1-12(2,3)20-10(18)14-13-6-8-7-15(4)11(19)16(5)9(8)17/h6-7H,1-5H3,(H,14,18)/b13-6+.
What are the key properties of tert-butyl N-[(E)-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methylideneamino]carbamate?
tert-butyl N-[(E)-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methylideneamino]carbamate has a molecular weight of 282.30 g/mol, XLogP of -0.06, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(E)-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methylideneamino]carbamate is sourced from PubChem (CID 42934987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).