C22H24N2O5S — CID 42935051
6-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 42935051) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is 6-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 42935051 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 6-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(NC(=O)C2CC=CCC2C(=O)O)cc1 |
| InChI | InChI=1S/C22H24N2O5S/c1-2-24(17-8-4-3-5-9-17)30(28,29)18-14-12-16(13-15-18)23-21(25)19-10-6-7-11-20(19)22(26)27/h3-9,12-15,19-20H,2,10-11H2,1H3,(H,23,25)(H,26,27) |
| InChIKey | RTMBCDLUAITJCY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|