C24H31N3O3 — CID 42935065
2-[3-methoxy-4-(2-oxopyrrolidin-1-yl)anilino]-N-(1-phenylbutyl)propanamide (PubChem CID 42935065) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-[3-methoxy-4-(2-oxopyrrolidin-1-yl)anilino]-N-(1-phenylbutyl)propanamide.
| Compound Name | 2-[3-methoxy-4-(2-oxopyrrolidin-1-yl)anilino]-N-(1-phenylbutyl)propanamide |
|---|---|
| PubChem CID | 42935065 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 2-[3-methoxy-4-(2-oxopyrrolidin-1-yl)anilino]-N-(1-phenylbutyl)propanamide |
| SMILES | CCCC(NC(=O)C(C)Nc1ccc(N2CCCC2=O)c(OC)c1)c1ccccc1 |
| InChI | InChI=1S/C24H31N3O3/c1-4-9-20(18-10-6-5-7-11-18)26-24(29)17(2)25-19-13-14-21(22(16-19)30-3)27-15-8-12-23(27)28/h5-7,10-11,13-14,16-17,20,25H,4,8-9,12,15H2,1-3H3,(H,26,29) |
| InChIKey | GJRJVNUTCGLJNX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |