C19H29N3O3S — CID 42935769
(2-cyclohexylimino-4-methyl-1-pyridinyl)-(1-methylsulfonylpiperidin-4-yl)methanone (PubChem CID 42935769) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is (2-cyclohexylimino-4-methyl-1-pyridinyl)-(1-methylsulfonylpiperidin-4-yl)methanone.
| Compound Name | (2-cyclohexylimino-4-methyl-1-pyridinyl)-(1-methylsulfonylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 42935769 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (2-cyclohexylimino-4-methyl-1-pyridinyl)-(1-methylsulfonylpiperidin-4-yl)methanone |
| SMILES | Cc1ccn(C(=O)C2CCN(S(C)(=O)=O)CC2)/c(=N/C2CCCCC2)c1 |
| InChI | InChI=1S/C19H29N3O3S/c1-15-8-13-22(18(14-15)20-17-6-4-3-5-7-17)19(23)16-9-11-21(12-10-16)26(2,24)25/h8,13-14,16-17H,3-7,9-12H2,1-2H3/b20-18+ |
| InChIKey | ZQKRXSRGFPSHEN-CZIZESTLSA-N |
| XLogP | 2.34 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |