About 3-[2-[1-(3,4-difluorophenyl)ethyl-methylamino]ethylsulfonyl]propanamide
3-[2-[1-(3,4-difluorophenyl)ethyl-methylamino]ethylsulfonyl]propanamide (PubChem CID 42936101) has the molecular formula C14H20F2N2O3S
and a molecular weight of 334.39 g/mol. Its IUPAC name is 3-[2-[1-(3,4-difluorophenyl)ethyl-methylamino]ethylsulfonyl]propanamide.
Molecular Properties
| Compound Name | 3-[2-[1-(3,4-difluorophenyl)ethyl-methylamino]ethylsulfonyl]propanamide |
| PubChem CID | 42936101 |
| Molecular Formula | C14H20F2N2O3S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 3-[2-[1-(3,4-difluorophenyl)ethyl-methylamino]ethylsulfonyl]propanamide |
| SMILES | CC(c1ccc(F)c(F)c1)N(C)CCS(=O)(=O)CCC(N)=O |
| InChI | InChI=1S/C14H20F2N2O3S/c1-10(11-3-4-12(15)13(16)9-11)18(2)6-8-22(20,21)7-5-14(17)19/h3-4,9-10H,5-8H2,1-2H3,(H2,17,19) |
| InChIKey | ZWLIJFSBPPCXON-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-[1-(3,4-difluorophenyl)ethyl-methylamino]ethylsulfonyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[1-(3,4-difluorophenyl)ethyl-methylamino]ethylsulfonyl]propanamide?
The IUPAC name of 3-[2-[1-(3,4-difluorophenyl)ethyl-methylamino]ethylsulfonyl]propanamide (CID 42936101) is 3-[2-[1-(3,4-difluorophenyl)ethyl-methylamino]ethylsulfonyl]propanamide.
What is the SMILES notation for 3-[2-[1-(3,4-difluorophenyl)ethyl-methylamino]ethylsulfonyl]propanamide?
The canonical SMILES for 3-[2-[1-(3,4-difluorophenyl)ethyl-methylamino]ethylsulfonyl]propanamide is CC(c1ccc(F)c(F)c1)N(C)CCS(=O)(=O)CCC(N)=O.
What is the InChIKey of 3-[2-[1-(3,4-difluorophenyl)ethyl-methylamino]ethylsulfonyl]propanamide?
The InChIKey is ZWLIJFSBPPCXON-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2N2O3S/c1-10(11-3-4-12(15)13(16)9-11)18(2)6-8-22(20,21)7-5-14(17)19/h3-4,9-10H,5-8H2,1-2H3,(H2,17,19).
What are the key properties of 3-[2-[1-(3,4-difluorophenyl)ethyl-methylamino]ethylsulfonyl]propanamide?
3-[2-[1-(3,4-difluorophenyl)ethyl-methylamino]ethylsulfonyl]propanamide has a molecular weight of 334.39 g/mol, XLogP of 1.25, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[1-(3,4-difluorophenyl)ethyl-methylamino]ethylsulfonyl]propanamide is sourced from PubChem (CID 42936101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).