About (6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-fluoroanilino)benzoate
(6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-fluoroanilino)benzoate (PubChem CID 42936478) has the molecular formula C23H18FN3O3
and a molecular weight of 403.41 g/mol. Its IUPAC name is (6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-fluoroanilino)benzoate.
Molecular Properties
| Compound Name | (6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-fluoroanilino)benzoate |
| PubChem CID | 42936478 |
| Molecular Formula | C23H18FN3O3 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-fluoroanilino)benzoate |
| SMILES | Cc1cccc2nc(COC(=O)c3ccccc3Nc3ccc(F)cc3)cc(=O)n12 |
| InChI | InChI=1S/C23H18FN3O3/c1-15-5-4-8-21-26-18(13-22(28)27(15)21)14-30-23(29)19-6-2-3-7-20(19)25-17-11-9-16(24)10-12-17/h2-13,25H,14H2,1H3 |
| InChIKey | UWYBPJSDYMYQLG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-fluoroanilino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-fluoroanilino)benzoate?
The IUPAC name of (6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-fluoroanilino)benzoate (CID 42936478) is (6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-fluoroanilino)benzoate.
What is the SMILES notation for (6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-fluoroanilino)benzoate?
The canonical SMILES for (6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-fluoroanilino)benzoate is Cc1cccc2nc(COC(=O)c3ccccc3Nc3ccc(F)cc3)cc(=O)n12.
What is the InChIKey of (6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-fluoroanilino)benzoate?
The InChIKey is UWYBPJSDYMYQLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18FN3O3/c1-15-5-4-8-21-26-18(13-22(28)27(15)21)14-30-23(29)19-6-2-3-7-20(19)25-17-11-9-16(24)10-12-17/h2-13,25H,14H2,1H3.
What are the key properties of (6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-fluoroanilino)benzoate?
(6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-fluoroanilino)benzoate has a molecular weight of 403.41 g/mol, XLogP of 4.24, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-fluoroanilino)benzoate is sourced from PubChem (CID 42936478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).