C42H45F3N2O6 — CID 4293649
1-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenyl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea (PubChem CID 4293649) has the molecular formula C42H45F3N2O6 and a molecular weight of 730.82 g/mol. Its IUPAC name is 1-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenyl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenyl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 4293649 |
| Molecular Formula | C42H45F3N2O6 |
| Molecular Weight | 730.82 g/mol |
| Exact Mass | 730.32 |
| IUPAC Name | 1-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenyl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccco4)=C3)C2CCC2(C)C1CCC2(O)CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C42H45F3N2O6/c1-37-17-14-29(48)23-39(37)20-21-41(31(24-39)35(49)32-9-6-22-52-32)33(37)15-18-38(2)34(41)16-19-40(38,51)26-47(36(50)46-28-7-4-3-5-8-28)25-27-10-12-30(13-11-27)53-42(43,44)45/h3-13,20-22,24,29,33-34,48,51H,14-19,23,25-26H2,1-2H3,(H,46,50) |
| InChIKey | OAXFTAZZARBSLJ-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.82 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|