C22H21N3O2S — CID 42936909
4-[3-(1-cyclopropyl-5-phenylimidazol-2-yl)sulfanyl-2-hydroxypropoxy]benzonitrile (PubChem CID 42936909) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 4-[3-(1-cyclopropyl-5-phenylimidazol-2-yl)sulfanyl-2-hydroxypropoxy]benzonitrile.
| Compound Name | 4-[3-(1-cyclopropyl-5-phenylimidazol-2-yl)sulfanyl-2-hydroxypropoxy]benzonitrile |
|---|---|
| PubChem CID | 42936909 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 4-[3-(1-cyclopropyl-5-phenylimidazol-2-yl)sulfanyl-2-hydroxypropoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCC(O)CSc2ncc(-c3ccccc3)n2C2CC2)cc1 |
| InChI | InChI=1S/C22H21N3O2S/c23-12-16-6-10-20(11-7-16)27-14-19(26)15-28-22-24-13-21(25(22)18-8-9-18)17-4-2-1-3-5-17/h1-7,10-11,13,18-19,26H,8-9,14-15H2 |
| InChIKey | TXROWRHYMQQJII-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |