C25H27N3O4 — CID 42937419
[2-oxo-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]ethyl] 6-cyclopropyl-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 42937419) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is [2-oxo-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]ethyl] 6-cyclopropyl-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | [2-oxo-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]ethyl] 6-cyclopropyl-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 42937419 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | [2-oxo-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]ethyl] 6-cyclopropyl-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | Cc1noc2nc(C3CC3)cc(C(=O)OCC(=O)NC(C)c3ccc4c(c3)CCCC4)c12 |
| InChI | InChI=1S/C25H27N3O4/c1-14(18-10-7-16-5-3-4-6-19(16)11-18)26-22(29)13-31-25(30)20-12-21(17-8-9-17)27-24-23(20)15(2)28-32-24/h7,10-12,14,17H,3-6,8-9,13H2,1-2H3,(H,26,29) |
| InChIKey | IOPZBWYDRJIPJI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |