About 4-ethyl-5-methyl-1,3-thiazol-2-amine;hydrobromide
4-ethyl-5-methyl-1,3-thiazol-2-amine;hydrobromide (PubChem CID 42937515) has the molecular formula C6H11BrN2S
and a molecular weight of 223.14 g/mol. Its IUPAC name is 4-ethyl-5-methyl-1,3-thiazol-2-amine;hydrobromide.
Molecular Properties
| Compound Name | 4-ethyl-5-methyl-1,3-thiazol-2-amine;hydrobromide |
| PubChem CID | 42937515 |
| Molecular Formula | C6H11BrN2S |
| Molecular Weight | 223.14 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | 4-ethyl-5-methyl-1,3-thiazol-2-amine;hydrobromide |
| SMILES | Br.CCc1nc(N)sc1C |
| InChI | InChI=1S/C6H10N2S.BrH/c1-3-5-4(2)9-6(7)8-5;/h3H2,1-2H3,(H2,7,8);1H |
| InChIKey | FQIXRKBHLXLGNC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.14 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-5-methyl-1,3-thiazol-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-5-methyl-1,3-thiazol-2-amine;hydrobromide?
The IUPAC name of 4-ethyl-5-methyl-1,3-thiazol-2-amine;hydrobromide (CID 42937515) is 4-ethyl-5-methyl-1,3-thiazol-2-amine;hydrobromide.
What is the SMILES notation for 4-ethyl-5-methyl-1,3-thiazol-2-amine;hydrobromide?
The canonical SMILES for 4-ethyl-5-methyl-1,3-thiazol-2-amine;hydrobromide is Br.CCc1nc(N)sc1C.
What is the InChIKey of 4-ethyl-5-methyl-1,3-thiazol-2-amine;hydrobromide?
The InChIKey is FQIXRKBHLXLGNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2S.BrH/c1-3-5-4(2)9-6(7)8-5;/h3H2,1-2H3,(H2,7,8);1H.
What are the key properties of 4-ethyl-5-methyl-1,3-thiazol-2-amine;hydrobromide?
4-ethyl-5-methyl-1,3-thiazol-2-amine;hydrobromide has a molecular weight of 223.14 g/mol, XLogP of 2.17, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5-methyl-1,3-thiazol-2-amine;hydrobromide is sourced from PubChem (CID 42937515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).