C21H18N2O3 — CID 42937673
(E)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-3-quinolin-8-ylprop-2-enamide (PubChem CID 42937673) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is (E)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-3-quinolin-8-ylprop-2-enamide.
| Compound Name | (E)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-3-quinolin-8-ylprop-2-enamide |
|---|---|
| PubChem CID | 42937673 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (E)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-3-quinolin-8-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccc2cccnc12)NCC1COc2ccccc2O1 |
| InChI | InChI=1S/C21H18N2O3/c24-20(11-10-16-6-3-5-15-7-4-12-22-21(15)16)23-13-17-14-25-18-8-1-2-9-19(18)26-17/h1-12,17H,13-14H2,(H,23,24)/b11-10+ |
| InChIKey | ZMRYRBMVKVFSPF-ZHACJKMWSA-N |
| XLogP | 3.20 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|