About 5-methyl-4-[(6-nitro-1,3-benzodioxol-5-yl)diazenyl]-2-phenyl-1H-pyrazol-3-one
5-methyl-4-[(6-nitro-1,3-benzodioxol-5-yl)diazenyl]-2-phenyl-1H-pyrazol-3-one (PubChem CID 4293777) has the molecular formula C17H13N5O5
and a molecular weight of 367.32 g/mol. Its IUPAC name is 5-methyl-4-[(6-nitro-1,3-benzodioxol-5-yl)diazenyl]-2-phenyl-1H-pyrazol-3-one.
Molecular Properties
| Compound Name | 5-methyl-4-[(6-nitro-1,3-benzodioxol-5-yl)diazenyl]-2-phenyl-1H-pyrazol-3-one |
| PubChem CID | 4293777 |
| Molecular Formula | C17H13N5O5 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 5-methyl-4-[(6-nitro-1,3-benzodioxol-5-yl)diazenyl]-2-phenyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1/N=N/c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C17H13N5O5/c1-10-16(17(23)21(20-10)11-5-3-2-4-6-11)19-18-12-7-14-15(27-9-26-14)8-13(12)22(24)25/h2-8,20H,9H2,1H3/b19-18+ |
| InChIKey | CFPBPRDTODVWPH-VHEBQXMUSA-N |
| XLogP | 3.53 |
| TPSA | 124.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-4-[(6-nitro-1,3-benzodioxol-5-yl)diazenyl]-2-phenyl-1H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-[(6-nitro-1,3-benzodioxol-5-yl)diazenyl]-2-phenyl-1H-pyrazol-3-one?
The IUPAC name of 5-methyl-4-[(6-nitro-1,3-benzodioxol-5-yl)diazenyl]-2-phenyl-1H-pyrazol-3-one (CID 4293777) is 5-methyl-4-[(6-nitro-1,3-benzodioxol-5-yl)diazenyl]-2-phenyl-1H-pyrazol-3-one.
What is the SMILES notation for 5-methyl-4-[(6-nitro-1,3-benzodioxol-5-yl)diazenyl]-2-phenyl-1H-pyrazol-3-one?
The canonical SMILES for 5-methyl-4-[(6-nitro-1,3-benzodioxol-5-yl)diazenyl]-2-phenyl-1H-pyrazol-3-one is Cc1[nH]n(-c2ccccc2)c(=O)c1/N=N/c1cc2c(cc1[N+](=O)[O-])OCO2.
What is the InChIKey of 5-methyl-4-[(6-nitro-1,3-benzodioxol-5-yl)diazenyl]-2-phenyl-1H-pyrazol-3-one?
The InChIKey is CFPBPRDTODVWPH-VHEBQXMUSA-N. The full InChI is InChI=1S/C17H13N5O5/c1-10-16(17(23)21(20-10)11-5-3-2-4-6-11)19-18-12-7-14-15(27-9-26-14)8-13(12)22(24)25/h2-8,20H,9H2,1H3/b19-18+.
What are the key properties of 5-methyl-4-[(6-nitro-1,3-benzodioxol-5-yl)diazenyl]-2-phenyl-1H-pyrazol-3-one?
5-methyl-4-[(6-nitro-1,3-benzodioxol-5-yl)diazenyl]-2-phenyl-1H-pyrazol-3-one has a molecular weight of 367.32 g/mol, XLogP of 3.53, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-[(6-nitro-1,3-benzodioxol-5-yl)diazenyl]-2-phenyl-1H-pyrazol-3-one is sourced from PubChem (CID 4293777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).