C23H37N3O4 — CID 42938424
4-ethoxy-N-[3-methyl-1-[(3-methyl-2-morpholin-4-ylbutyl)amino]-1-oxobutan-2-yl]benzamide (PubChem CID 42938424) has the molecular formula C23H37N3O4 and a molecular weight of 419.57 g/mol. Its IUPAC name is 4-ethoxy-N-[3-methyl-1-[(3-methyl-2-morpholin-4-ylbutyl)amino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-ethoxy-N-[3-methyl-1-[(3-methyl-2-morpholin-4-ylbutyl)amino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 42938424 |
| Molecular Formula | C23H37N3O4 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | 4-ethoxy-N-[3-methyl-1-[(3-methyl-2-morpholin-4-ylbutyl)amino]-1-oxobutan-2-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)NC(C(=O)NCC(C(C)C)N2CCOCC2)C(C)C)cc1 |
| InChI | InChI=1S/C23H37N3O4/c1-6-30-19-9-7-18(8-10-19)22(27)25-21(17(4)5)23(28)24-15-20(16(2)3)26-11-13-29-14-12-26/h7-10,16-17,20-21H,6,11-15H2,1-5H3,(H,24,28)(H,25,27) |
| InChIKey | VFTKPBCXZZGQOK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |