C20H20FN3O5 — CID 42939894
1-(3-fluoro-4-methylphenyl)-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 42939894) has the molecular formula C20H20FN3O5 and a molecular weight of 401.39 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3-fluoro-4-methylphenyl)-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42939894 |
| Molecular Formula | C20H20FN3O5 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2CC(C(=O)NCC(O)c3ccc([N+](=O)[O-])cc3)CC2=O)cc1F |
| InChI | InChI=1S/C20H20FN3O5/c1-12-2-5-16(9-17(12)21)23-11-14(8-19(23)26)20(27)22-10-18(25)13-3-6-15(7-4-13)24(28)29/h2-7,9,14,18,25H,8,10-11H2,1H3,(H,22,27) |
| InChIKey | VKRHTOIYMKUYQZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|