About diethyl (4-oxo-1,2,3-benzotriazin-3-yl) phosphate
diethyl (4-oxo-1,2,3-benzotriazin-3-yl) phosphate (PubChem CID 4293995) has the molecular formula C11H14N3O5P
and a molecular weight of 299.22 g/mol. Its IUPAC name is diethyl (4-oxo-1,2,3-benzotriazin-3-yl) phosphate.
Molecular Properties
| Compound Name | diethyl (4-oxo-1,2,3-benzotriazin-3-yl) phosphate |
| PubChem CID | 4293995 |
| Molecular Formula | C11H14N3O5P |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | diethyl (4-oxo-1,2,3-benzotriazin-3-yl) phosphate |
| SMILES | CCOP(=O)(OCC)On1nnc2ccccc2c1=O |
| InChI | InChI=1S/C11H14N3O5P/c1-3-17-20(16,18-4-2)19-14-11(15)9-7-5-6-8-10(9)12-13-14/h5-8H,3-4H2,1-2H3 |
| InChIKey | AJDPNPAGZMZOMN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethyl (4-oxo-1,2,3-benzotriazin-3-yl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (4-oxo-1,2,3-benzotriazin-3-yl) phosphate?
The IUPAC name of diethyl (4-oxo-1,2,3-benzotriazin-3-yl) phosphate (CID 4293995) is diethyl (4-oxo-1,2,3-benzotriazin-3-yl) phosphate.
What is the SMILES notation for diethyl (4-oxo-1,2,3-benzotriazin-3-yl) phosphate?
The canonical SMILES for diethyl (4-oxo-1,2,3-benzotriazin-3-yl) phosphate is CCOP(=O)(OCC)On1nnc2ccccc2c1=O.
What is the InChIKey of diethyl (4-oxo-1,2,3-benzotriazin-3-yl) phosphate?
The InChIKey is AJDPNPAGZMZOMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N3O5P/c1-3-17-20(16,18-4-2)19-14-11(15)9-7-5-6-8-10(9)12-13-14/h5-8H,3-4H2,1-2H3.
What are the key properties of diethyl (4-oxo-1,2,3-benzotriazin-3-yl) phosphate?
diethyl (4-oxo-1,2,3-benzotriazin-3-yl) phosphate has a molecular weight of 299.22 g/mol, XLogP of 1.40, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (4-oxo-1,2,3-benzotriazin-3-yl) phosphate is sourced from PubChem (CID 4293995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).