About Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzothiophene-6-carboxylate
Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzothiophene-6-carboxylate (PubChem CID 4294214) has the molecular formula C10H10O3S
and a molecular weight of 210.25 g/mol. Its IUPAC name is methyl 4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylate.
Analyze Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzothiophene-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzothiophene-6-carboxylate?
The IUPAC name of Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzothiophene-6-carboxylate (CID 4294214) is methyl 4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylate.
What is the SMILES notation for Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzothiophene-6-carboxylate?
The canonical SMILES for Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzothiophene-6-carboxylate is COC(=O)C1CC2=C(C=CS2)C(=O)C1.
What is the InChIKey of Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzothiophene-6-carboxylate?
The InChIKey is CXQNQXURUHDCEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3S/c1-13-10(12)6-4-8(11)7-2-3-14-9(7)5-6/h2-3,6H,4-5H2,1H3.
What are the key properties of Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzothiophene-6-carboxylate?
Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzothiophene-6-carboxylate has a molecular weight of 210.25 g/mol, XLogP of 1.20, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzothiophene-6-carboxylate is sourced from PubChem (CID 4294214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).