C13H17F4NO3 — CID 4294233
2,2,3,3-tetrafluoropropyl 4-[bis(prop-2-enyl)amino]-4-oxobutanoate (PubChem CID 4294233) has the molecular formula C13H17F4NO3 and a molecular weight of 311.27 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 4-[bis(prop-2-enyl)amino]-4-oxobutanoate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 4-[bis(prop-2-enyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4294233 |
| Molecular Formula | C13H17F4NO3 |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 4-[bis(prop-2-enyl)amino]-4-oxobutanoate |
| SMILES | C=CCN(CC=C)C(=O)CCC(=O)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C13H17F4NO3/c1-3-7-18(8-4-2)10(19)5-6-11(20)21-9-13(16,17)12(14)15/h3-4,12H,1-2,5-9H2 |
| InChIKey | CXROSGXUIFKURX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|