C31H35N11O2 — CID 42943005
6-[[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl-[(3,4-dimethoxyphenyl)methyl]amino]methyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 42943005) has the molecular formula C31H35N11O2 and a molecular weight of 593.70 g/mol. Its IUPAC name is 6-[[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl-[(3,4-dimethoxyphenyl)methyl]amino]methyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl-[(3,4-dimethoxyphenyl)methyl]amino]methyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 42943005 |
| Molecular Formula | C31H35N11O2 |
| Molecular Weight | 593.70 g/mol |
| Exact Mass | 593.30 |
| IUPAC Name | 6-[[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl-[(3,4-dimethoxyphenyl)methyl]amino]methyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(CN(Cc2nc(N)nc(Nc3ccccc3C)n2)Cc2nc(N)nc(Nc3ccccc3C)n2)cc1OC |
| InChI | InChI=1S/C31H35N11O2/c1-19-9-5-7-11-22(19)34-30-38-26(36-28(32)40-30)17-42(16-21-13-14-24(43-3)25(15-21)44-4)18-27-37-29(33)41-31(39-27)35-23-12-8-6-10-20(23)2/h5-15H,16-18H2,1-4H3,(H3,32,34,36,38,40)(H3,33,35,37,39,41) |
| InChIKey | VUUXGTLJOOTSBX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 175.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.70 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |