C16H20N2O4S — CID 42943434
methyl 3-[1-[2-(4-methoxyphenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]propanoate (PubChem CID 42943434) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is methyl 3-[1-[2-(4-methoxyphenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]propanoate.
| Compound Name | methyl 3-[1-[2-(4-methoxyphenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]propanoate |
|---|---|
| PubChem CID | 42943434 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | methyl 3-[1-[2-(4-methoxyphenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]propanoate |
| SMILES | COC(=O)CCC1NC(=S)N(CCc2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C16H20N2O4S/c1-21-12-5-3-11(4-6-12)9-10-18-15(20)13(17-16(18)23)7-8-14(19)22-2/h3-6,13H,7-10H2,1-2H3,(H,17,23) |
| InChIKey | JLQLMKCPSAEDJJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|