About 3-methyl-5-(methylamino)-N-[3-(trifluoromethyl)cyclohexyl]-1,2-thiazole-4-carboxamide
3-methyl-5-(methylamino)-N-[3-(trifluoromethyl)cyclohexyl]-1,2-thiazole-4-carboxamide (PubChem CID 42944897) has the molecular formula C13H18F3N3OS
and a molecular weight of 321.37 g/mol. Its IUPAC name is 3-methyl-5-(methylamino)-N-[3-(trifluoromethyl)cyclohexyl]-1,2-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-methyl-5-(methylamino)-N-[3-(trifluoromethyl)cyclohexyl]-1,2-thiazole-4-carboxamide |
| PubChem CID | 42944897 |
| Molecular Formula | C13H18F3N3OS |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3-methyl-5-(methylamino)-N-[3-(trifluoromethyl)cyclohexyl]-1,2-thiazole-4-carboxamide |
| SMILES | CNc1snc(C)c1C(=O)NC1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H18F3N3OS/c1-7-10(12(17-2)21-19-7)11(20)18-9-5-3-4-8(6-9)13(14,15)16/h8-9,17H,3-6H2,1-2H3,(H,18,20) |
| InChIKey | KPFPBBRXOZRSOF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-5-(methylamino)-N-[3-(trifluoromethyl)cyclohexyl]-1,2-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-(methylamino)-N-[3-(trifluoromethyl)cyclohexyl]-1,2-thiazole-4-carboxamide?
The IUPAC name of 3-methyl-5-(methylamino)-N-[3-(trifluoromethyl)cyclohexyl]-1,2-thiazole-4-carboxamide (CID 42944897) is 3-methyl-5-(methylamino)-N-[3-(trifluoromethyl)cyclohexyl]-1,2-thiazole-4-carboxamide.
What is the SMILES notation for 3-methyl-5-(methylamino)-N-[3-(trifluoromethyl)cyclohexyl]-1,2-thiazole-4-carboxamide?
The canonical SMILES for 3-methyl-5-(methylamino)-N-[3-(trifluoromethyl)cyclohexyl]-1,2-thiazole-4-carboxamide is CNc1snc(C)c1C(=O)NC1CCCC(C(F)(F)F)C1.
What is the InChIKey of 3-methyl-5-(methylamino)-N-[3-(trifluoromethyl)cyclohexyl]-1,2-thiazole-4-carboxamide?
The InChIKey is KPFPBBRXOZRSOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F3N3OS/c1-7-10(12(17-2)21-19-7)11(20)18-9-5-3-4-8(6-9)13(14,15)16/h8-9,17H,3-6H2,1-2H3,(H,18,20).
What are the key properties of 3-methyl-5-(methylamino)-N-[3-(trifluoromethyl)cyclohexyl]-1,2-thiazole-4-carboxamide?
3-methyl-5-(methylamino)-N-[3-(trifluoromethyl)cyclohexyl]-1,2-thiazole-4-carboxamide has a molecular weight of 321.37 g/mol, XLogP of 3.34, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-(methylamino)-N-[3-(trifluoromethyl)cyclohexyl]-1,2-thiazole-4-carboxamide is sourced from PubChem (CID 42944897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).