About 2-amino-N,N,4-trimethylpentanamide;hydrochloride
2-amino-N,N,4-trimethylpentanamide;hydrochloride (PubChem CID 42944933) has the molecular formula C8H19ClN2O
and a molecular weight of 194.71 g/mol. Its IUPAC name is 2-amino-N,N,4-trimethylpentanamide;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-N,N,4-trimethylpentanamide;hydrochloride |
| PubChem CID | 42944933 |
| Molecular Formula | C8H19ClN2O |
| Molecular Weight | 194.71 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-amino-N,N,4-trimethylpentanamide;hydrochloride |
| SMILES | CC(C)CC(N)C(=O)N(C)C.Cl |
| InChI | InChI=1S/C8H18N2O.ClH/c1-6(2)5-7(9)8(11)10(3)4;/h6-7H,5,9H2,1-4H3;1H |
| InChIKey | WBAHRUNBZZZHKT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.71 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-N,N,4-trimethylpentanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N,N,4-trimethylpentanamide;hydrochloride?
The IUPAC name of 2-amino-N,N,4-trimethylpentanamide;hydrochloride (CID 42944933) is 2-amino-N,N,4-trimethylpentanamide;hydrochloride.
What is the SMILES notation for 2-amino-N,N,4-trimethylpentanamide;hydrochloride?
The canonical SMILES for 2-amino-N,N,4-trimethylpentanamide;hydrochloride is CC(C)CC(N)C(=O)N(C)C.Cl.
What is the InChIKey of 2-amino-N,N,4-trimethylpentanamide;hydrochloride?
The InChIKey is WBAHRUNBZZZHKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O.ClH/c1-6(2)5-7(9)8(11)10(3)4;/h6-7H,5,9H2,1-4H3;1H.
What are the key properties of 2-amino-N,N,4-trimethylpentanamide;hydrochloride?
2-amino-N,N,4-trimethylpentanamide;hydrochloride has a molecular weight of 194.71 g/mol, XLogP of 0.87, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N,N,4-trimethylpentanamide;hydrochloride is sourced from PubChem (CID 42944933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).