C20H21ClN4O3 — CID 42945110
1-[3-(tetrazol-1-yl)phenyl]ethyl 4-(4-chloro-2-methylphenoxy)butanoate (PubChem CID 42945110) has the molecular formula C20H21ClN4O3 and a molecular weight of 400.87 g/mol. Its IUPAC name is 1-[3-(tetrazol-1-yl)phenyl]ethyl 4-(4-chloro-2-methylphenoxy)butanoate.
| Compound Name | 1-[3-(tetrazol-1-yl)phenyl]ethyl 4-(4-chloro-2-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 42945110 |
| Molecular Formula | C20H21ClN4O3 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 1-[3-(tetrazol-1-yl)phenyl]ethyl 4-(4-chloro-2-methylphenoxy)butanoate |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)OC(C)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C20H21ClN4O3/c1-14-11-17(21)8-9-19(14)27-10-4-7-20(26)28-15(2)16-5-3-6-18(12-16)25-13-22-23-24-25/h3,5-6,8-9,11-13,15H,4,7,10H2,1-2H3 |
| InChIKey | VMMMTXGBRBFJGU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|