About 2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-1-phenylethanol
2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-1-phenylethanol (PubChem CID 42945416) has the molecular formula C21H22N2O
and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-1-phenylethanol.
Molecular Properties
| Compound Name | 2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-1-phenylethanol |
| PubChem CID | 42945416 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-1-phenylethanol |
| SMILES | OC(CN1CC=C(c2c[nH]c3ccccc23)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O/c24-21(17-6-2-1-3-7-17)15-23-12-10-16(11-13-23)19-14-22-20-9-5-4-8-18(19)20/h1-10,14,21-22,24H,11-13,15H2 |
| InChIKey | XCINSJOBIPZONT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-1-phenylethanol?
The IUPAC name of 2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-1-phenylethanol (CID 42945416) is 2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-1-phenylethanol.
What is the SMILES notation for 2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-1-phenylethanol?
The canonical SMILES for 2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-1-phenylethanol is OC(CN1CC=C(c2c[nH]c3ccccc23)CC1)c1ccccc1.
What is the InChIKey of 2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-1-phenylethanol?
The InChIKey is XCINSJOBIPZONT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O/c24-21(17-6-2-1-3-7-17)15-23-12-10-16(11-13-23)19-14-22-20-9-5-4-8-18(19)20/h1-10,14,21-22,24H,11-13,15H2.
What are the key properties of 2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-1-phenylethanol?
2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-1-phenylethanol has a molecular weight of 318.42 g/mol, XLogP of 3.99, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-1-phenylethanol is sourced from PubChem (CID 42945416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).