C13H21N5S — CID 42945459
1-prop-2-enyl-3-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]thiourea (PubChem CID 42945459) has the molecular formula C13H21N5S and a molecular weight of 279.41 g/mol. Its IUPAC name is 1-prop-2-enyl-3-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]thiourea.
| Compound Name | 1-prop-2-enyl-3-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 42945459 |
| Molecular Formula | C13H21N5S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 1-prop-2-enyl-3-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]thiourea |
| SMILES | C=CCNC(=S)NC(C)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C13H21N5S/c1-3-8-14-13(19)15-10(2)12-17-16-11-7-5-4-6-9-18(11)12/h3,10H,1,4-9H2,2H3,(H2,14,15,19) |
| InChIKey | XIKYSHJZHVVDEB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|