C20H20ClN3O2 — CID 42947640
N-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-(1-phenylpyrazol-4-yl)propanamide (PubChem CID 42947640) has the molecular formula C20H20ClN3O2 and a molecular weight of 369.85 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-(1-phenylpyrazol-4-yl)propanamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-(1-phenylpyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 42947640 |
| Molecular Formula | C20H20ClN3O2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-(1-phenylpyrazol-4-yl)propanamide |
| SMILES | O=C(CCc1cnn(-c2ccccc2)c1)NCC(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClN3O2/c21-17-9-7-16(8-10-17)19(25)13-22-20(26)11-6-15-12-23-24(14-15)18-4-2-1-3-5-18/h1-5,7-10,12,14,19,25H,6,11,13H2,(H,22,26) |
| InChIKey | JUJZBIXEKVECDD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |