C20H20ClN3O3 — CID 42947647
N-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-(8-methyl-4-oxoquinazolin-3-yl)propanamide (PubChem CID 42947647) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-(8-methyl-4-oxoquinazolin-3-yl)propanamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-(8-methyl-4-oxoquinazolin-3-yl)propanamide |
|---|---|
| PubChem CID | 42947647 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-(8-methyl-4-oxoquinazolin-3-yl)propanamide |
| SMILES | Cc1cccc2c(=O)n(CCC(=O)NCC(O)c3ccc(Cl)cc3)cnc12 |
| InChI | InChI=1S/C20H20ClN3O3/c1-13-3-2-4-16-19(13)23-12-24(20(16)27)10-9-18(26)22-11-17(25)14-5-7-15(21)8-6-14/h2-8,12,17,25H,9-11H2,1H3,(H,22,26) |
| InChIKey | BTPNDYKKLWSEHU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |