About N-propan-2-yl-2-(1,2,4-triazol-1-yl)propanamide
N-propan-2-yl-2-(1,2,4-triazol-1-yl)propanamide (PubChem CID 42947749) has the molecular formula C8H14N4O
and a molecular weight of 182.23 g/mol. Its IUPAC name is N-propan-2-yl-2-(1,2,4-triazol-1-yl)propanamide.
Molecular Properties
| Compound Name | N-propan-2-yl-2-(1,2,4-triazol-1-yl)propanamide |
| PubChem CID | 42947749 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | N-propan-2-yl-2-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CC(C)NC(=O)C(C)n1cncn1 |
| InChI | InChI=1S/C8H14N4O/c1-6(2)11-8(13)7(3)12-5-9-4-10-12/h4-7H,1-3H3,(H,11,13) |
| InChIKey | FMFCFLWJIXWTQQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-propan-2-yl-2-(1,2,4-triazol-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-2-(1,2,4-triazol-1-yl)propanamide?
The IUPAC name of N-propan-2-yl-2-(1,2,4-triazol-1-yl)propanamide (CID 42947749) is N-propan-2-yl-2-(1,2,4-triazol-1-yl)propanamide.
What is the SMILES notation for N-propan-2-yl-2-(1,2,4-triazol-1-yl)propanamide?
The canonical SMILES for N-propan-2-yl-2-(1,2,4-triazol-1-yl)propanamide is CC(C)NC(=O)C(C)n1cncn1.
What is the InChIKey of N-propan-2-yl-2-(1,2,4-triazol-1-yl)propanamide?
The InChIKey is FMFCFLWJIXWTQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O/c1-6(2)11-8(13)7(3)12-5-9-4-10-12/h4-7H,1-3H3,(H,11,13).
What are the key properties of N-propan-2-yl-2-(1,2,4-triazol-1-yl)propanamide?
N-propan-2-yl-2-(1,2,4-triazol-1-yl)propanamide has a molecular weight of 182.23 g/mol, XLogP of 0.36, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-2-(1,2,4-triazol-1-yl)propanamide is sourced from PubChem (CID 42947749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).