C23H26N6O2S — CID 42947980
4-phenyl-8-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one (PubChem CID 42947980) has the molecular formula C23H26N6O2S and a molecular weight of 450.57 g/mol. Its IUPAC name is 4-phenyl-8-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one.
| Compound Name | 4-phenyl-8-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one |
|---|---|
| PubChem CID | 42947980 |
| Molecular Formula | C23H26N6O2S |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 4-phenyl-8-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one |
| SMILES | CC(C)c1noc(C(C)Sc2nc3nn(-c4ccccc4)c(=O)c-3c3n2CCCCC3)n1 |
| InChI | InChI=1S/C23H26N6O2S/c1-14(2)19-24-21(31-27-19)15(3)32-23-25-20-18(17-12-8-5-9-13-28(17)23)22(30)29(26-20)16-10-6-4-7-11-16/h4,6-7,10-11,14-15H,5,8-9,12-13H2,1-3H3 |
| InChIKey | YGCBCGWDUZXXTQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 91.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |