About 2-amino-N,N-dimethyl-4-methylsulfonylbutanamide;hydrobromide
2-amino-N,N-dimethyl-4-methylsulfonylbutanamide;hydrobromide (PubChem CID 42948602) has the molecular formula C7H17BrN2O3S
and a molecular weight of 289.19 g/mol. Its IUPAC name is 2-amino-N,N-dimethyl-4-methylsulfonylbutanamide;hydrobromide.
Molecular Properties
| Compound Name | 2-amino-N,N-dimethyl-4-methylsulfonylbutanamide;hydrobromide |
| PubChem CID | 42948602 |
| Molecular Formula | C7H17BrN2O3S |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 2-amino-N,N-dimethyl-4-methylsulfonylbutanamide;hydrobromide |
| SMILES | Br.CN(C)C(=O)C(N)CCS(C)(=O)=O |
| InChI | InChI=1S/C7H16N2O3S.BrH/c1-9(2)7(10)6(8)4-5-13(3,11)12;/h6H,4-5,8H2,1-3H3;1H |
| InChIKey | PPXYIGUXJYWJAX-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-N,N-dimethyl-4-methylsulfonylbutanamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N,N-dimethyl-4-methylsulfonylbutanamide;hydrobromide?
The IUPAC name of 2-amino-N,N-dimethyl-4-methylsulfonylbutanamide;hydrobromide (CID 42948602) is 2-amino-N,N-dimethyl-4-methylsulfonylbutanamide;hydrobromide.
What is the SMILES notation for 2-amino-N,N-dimethyl-4-methylsulfonylbutanamide;hydrobromide?
The canonical SMILES for 2-amino-N,N-dimethyl-4-methylsulfonylbutanamide;hydrobromide is Br.CN(C)C(=O)C(N)CCS(C)(=O)=O.
What is the InChIKey of 2-amino-N,N-dimethyl-4-methylsulfonylbutanamide;hydrobromide?
The InChIKey is PPXYIGUXJYWJAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O3S.BrH/c1-9(2)7(10)6(8)4-5-13(3,11)12;/h6H,4-5,8H2,1-3H3;1H.
What are the key properties of 2-amino-N,N-dimethyl-4-methylsulfonylbutanamide;hydrobromide?
2-amino-N,N-dimethyl-4-methylsulfonylbutanamide;hydrobromide has a molecular weight of 289.19 g/mol, XLogP of -0.59, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N,N-dimethyl-4-methylsulfonylbutanamide;hydrobromide is sourced from PubChem (CID 42948602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).