C15H20N4O3 — CID 42948760
1-[2-(methylcarbamoylamino)-2-oxoethyl]-N-phenylpyrrolidine-2-carboxamide (PubChem CID 42948760) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-[2-(methylcarbamoylamino)-2-oxoethyl]-N-phenylpyrrolidine-2-carboxamide.
| Compound Name | 1-[2-(methylcarbamoylamino)-2-oxoethyl]-N-phenylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 42948760 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-[2-(methylcarbamoylamino)-2-oxoethyl]-N-phenylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)NC(=O)CN1CCCC1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H20N4O3/c1-16-15(22)18-13(20)10-19-9-5-8-12(19)14(21)17-11-6-3-2-4-7-11/h2-4,6-7,12H,5,8-10H2,1H3,(H,17,21)(H2,16,18,20,22) |
| InChIKey | IXFPVDAMMNALKZ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |