C11H24Cl2N2O — CID 42948939
2,6-dimethyl-4-piperidin-4-ylmorpholine;dihydrochloride (PubChem CID 42948939) has the molecular formula C11H24Cl2N2O and a molecular weight of 271.23 g/mol. Its IUPAC name is 2,6-dimethyl-4-piperidin-4-ylmorpholine;dihydrochloride.
| Compound Name | 2,6-dimethyl-4-piperidin-4-ylmorpholine;dihydrochloride |
|---|---|
| PubChem CID | 42948939 |
| Molecular Formula | C11H24Cl2N2O |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2,6-dimethyl-4-piperidin-4-ylmorpholine;dihydrochloride |
| SMILES | CC1CN(C2CCNCC2)CC(C)O1.Cl.Cl |
| InChI | InChI=1S/C11H22N2O.2ClH/c1-9-7-13(8-10(2)14-9)11-3-5-12-6-4-11;;/h9-12H,3-8H2,1-2H3;2*1H |
| InChIKey | QAECYNOAAVFDNH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |