C19H18Cl2FNO3 — CID 42949362
2-(2,4-dichlorophenoxy)-1-[2-(4-fluorophenyl)morpholin-4-yl]propan-1-one (PubChem CID 42949362) has the molecular formula C19H18Cl2FNO3 and a molecular weight of 398.26 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-1-[2-(4-fluorophenyl)morpholin-4-yl]propan-1-one.
| Compound Name | 2-(2,4-dichlorophenoxy)-1-[2-(4-fluorophenyl)morpholin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 42949362 |
| Molecular Formula | C19H18Cl2FNO3 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-1-[2-(4-fluorophenyl)morpholin-4-yl]propan-1-one |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)N1CCOC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H18Cl2FNO3/c1-12(26-17-7-4-14(20)10-16(17)21)19(24)23-8-9-25-18(11-23)13-2-5-15(22)6-3-13/h2-7,10,12,18H,8-9,11H2,1H3 |
| InChIKey | IVVXSSMRCMNCOF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |