C20H26FN3O3 — CID 42949673
3-[[2-(4-fluorophenyl)morpholin-4-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 42949673) has the molecular formula C20H26FN3O3 and a molecular weight of 375.44 g/mol. Its IUPAC name is 3-[[2-(4-fluorophenyl)morpholin-4-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[2-(4-fluorophenyl)morpholin-4-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 42949673 |
| Molecular Formula | C20H26FN3O3 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 3-[[2-(4-fluorophenyl)morpholin-4-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CCC2(CC1)NC(=O)N(CN1CCOC(c3ccc(F)cc3)C1)C2=O |
| InChI | InChI=1S/C20H26FN3O3/c1-14-6-8-20(9-7-14)18(25)24(19(26)22-20)13-23-10-11-27-17(12-23)15-2-4-16(21)5-3-15/h2-5,14,17H,6-13H2,1H3,(H,22,26) |
| InChIKey | DNZZDLLTTHWSEQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|