C19H23FN4OS — CID 42949677
4,5-dicyclopropyl-2-[[2-(4-fluorophenyl)morpholin-4-yl]methyl]-1,2,4-triazole-3-thione (PubChem CID 42949677) has the molecular formula C19H23FN4OS and a molecular weight of 374.49 g/mol. Its IUPAC name is 4,5-dicyclopropyl-2-[[2-(4-fluorophenyl)morpholin-4-yl]methyl]-1,2,4-triazole-3-thione.
| Compound Name | 4,5-dicyclopropyl-2-[[2-(4-fluorophenyl)morpholin-4-yl]methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 42949677 |
| Molecular Formula | C19H23FN4OS |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 4,5-dicyclopropyl-2-[[2-(4-fluorophenyl)morpholin-4-yl]methyl]-1,2,4-triazole-3-thione |
| SMILES | Fc1ccc(C2CN(Cn3nc(C4CC4)n(C4CC4)c3=S)CCO2)cc1 |
| InChI | InChI=1S/C19H23FN4OS/c20-15-5-3-13(4-6-15)17-11-22(9-10-25-17)12-23-19(26)24(16-7-8-16)18(21-23)14-1-2-14/h3-6,14,16-17H,1-2,7-12H2 |
| InChIKey | IJVFACFQRRKQMB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|