C20H24FNO3S — CID 42949942
2-(4-fluorophenyl)-4-(2,3,5,6-tetramethylphenyl)sulfonylmorpholine (PubChem CID 42949942) has the molecular formula C20H24FNO3S and a molecular weight of 377.48 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-(2,3,5,6-tetramethylphenyl)sulfonylmorpholine.
| Compound Name | 2-(4-fluorophenyl)-4-(2,3,5,6-tetramethylphenyl)sulfonylmorpholine |
|---|---|
| PubChem CID | 42949942 |
| Molecular Formula | C20H24FNO3S |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-(4-fluorophenyl)-4-(2,3,5,6-tetramethylphenyl)sulfonylmorpholine |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCOC(c3ccc(F)cc3)C2)c1C |
| InChI | InChI=1S/C20H24FNO3S/c1-13-11-14(2)16(4)20(15(13)3)26(23,24)22-9-10-25-19(12-22)17-5-7-18(21)8-6-17/h5-8,11,19H,9-10,12H2,1-4H3 |
| InChIKey | IQLKSZKKSLPIFZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |